C22H27OP — CID 46184298
(1S,2R,4S)-2-diphenylphosphoryl-1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 46184298) has the molecular formula C22H27OP and a molecular weight of 338.43 g/mol. Its IUPAC name is (1S,2R,4S)-2-diphenylphosphoryl-1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4S)-2-diphenylphosphoryl-1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 46184298 |
| Molecular Formula | C22H27OP |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (1S,2R,4S)-2-diphenylphosphoryl-1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](P(=O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H27OP/c1-21(2)17-14-15-22(21,3)20(16-17)24(23,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20H,14-16H2,1-3H3/t17-,20+,22+/m0/s1 |
| InChIKey | MPAOKENPCXDUQB-UCNVEGJOSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|