C36H54O3 — CID 46184316
(1R,2S,9R,10S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10-trimethyl-9-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione (PubChem CID 46184316) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is (1R,2S,9R,10S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10-trimethyl-9-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione.
| Compound Name | (1R,2S,9R,10S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10-trimethyl-9-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
|---|---|
| PubChem CID | 46184316 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (1R,2S,9R,10S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10-trimethyl-9-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@H]1CC(C)(C)OC2=CC(=O)[C@]3(CC=C(C)C)C(=O)[C@@]21CC[C@]3(C)CCC=C(C)C |
| InChI | InChI=1S/C36H54O3/c1-25(2)13-11-15-28(7)16-17-29-24-33(8,9)39-31-23-30(37)36(20-18-27(5)6)32(38)35(29,31)22-21-34(36,10)19-12-14-26(3)4/h13-14,16,18,23,29H,11-12,15,17,19-22,24H2,1-10H3/b28-16+/t29-,34-,35+,36+/m0/s1 |
| InChIKey | VQYDFTBIHSSFEQ-RPVCVHJASA-N |
| XLogP | 9.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|