C23H19ClFNO3S — CID 46184396
1'-[(2-chloro-6-fluorophenyl)methyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 46184396) has the molecular formula C23H19ClFNO3S and a molecular weight of 443.93 g/mol. Its IUPAC name is 1'-[(2-chloro-6-fluorophenyl)methyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 1'-[(2-chloro-6-fluorophenyl)methyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 46184396 |
| Molecular Formula | C23H19ClFNO3S |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1'-[(2-chloro-6-fluorophenyl)methyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1SCC1(CCN(Cc3c(F)cccc3Cl)CC1)O2 |
| InChI | InChI=1S/C23H19ClFNO3S/c24-17-6-3-7-18(25)16(17)12-26-10-8-23(9-11-26)13-30-22-20(28)19(27)14-4-1-2-5-15(14)21(22)29-23/h1-7H,8-13H2 |
| InChIKey | HDCSPRHHLIMSTJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|