C22H27P — CID 46184537
diphenyl-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]phosphane (PubChem CID 46184537) has the molecular formula C22H27P and a molecular weight of 322.43 g/mol. Its IUPAC name is diphenyl-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]phosphane.
| Compound Name | diphenyl-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]phosphane |
|---|---|
| PubChem CID | 46184537 |
| Molecular Formula | C22H27P |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | diphenyl-[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]phosphane |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27P/c1-21(2)17-14-15-22(3,16-17)20(21)23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20H,14-16H2,1-3H3/t17-,20-,22+/m0/s1 |
| InChIKey | BCGHFWMLSHFCPO-RBDMOPTHSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|