C26H30N2O2 — CID 46184586
(3S)-4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxamide (PubChem CID 46184586) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (3S)-4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxamide.
| Compound Name | (3S)-4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 46184586 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (3S)-4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxamide |
| SMILES | CC1(C)C(=O)N(C2C3CC4C[C@H]2CC(C(N)=O)(C4)C3)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O2/c1-25(2)22(20-9-5-7-16-6-3-4-8-19(16)20)28(24(25)30)21-17-10-15-11-18(21)14-26(12-15,13-17)23(27)29/h3-9,15,17-18,21-22H,10-14H2,1-2H3,(H2,27,29)/t15?,17-,18?,21?,22?,26?/m0/s1 |
| InChIKey | JWCRTHLETKJHPZ-RVKDFECISA-N |
| XLogP | 4.43 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |