C31H43NO3 — CID 46184627
(2R,4aS,6aR,6aS,14aS,14bR)-N-ethyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide (PubChem CID 46184627) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-N-ethyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-N-ethyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 46184627 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-N-ethyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
| SMILES | CCNC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C31H43NO3/c1-8-32-26(35)28(4)12-11-27(3)13-15-30(6)23-10-9-20-19(2)25(34)22(33)17-21(20)29(23,5)14-16-31(30,7)24(27)18-28/h9-10,17,24,34H,8,11-16,18H2,1-7H3,(H,32,35)/t24-,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | YGLDJGRHKCVIQN-ZRCCSVPJSA-N |
| XLogP | 6.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |