C26H44O5Si — CID 46184746
ethyl (2E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,8-dienoate (PubChem CID 46184746) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is ethyl (2E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,8-dienoate.
| Compound Name | ethyl (2E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,8-dienoate |
|---|---|
| PubChem CID | 46184746 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | ethyl (2E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5S)-5-but-3-ynyl-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,8-dienoate |
| SMILES | C#CCC[C@@H]1OC(C)(C)O[C@H]1/C=C/[C@H](CCC/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O5Si/c1-10-12-17-22-23(30-26(6,7)29-22)20-19-21(31-32(8,9)25(3,4)5)16-14-13-15-18-24(27)28-11-2/h1,15,18-23H,11-14,16-17H2,2-9H3/b18-15+,20-19+/t21-,22-,23-/m0/s1 |
| InChIKey | GFHUZQWWLHXKHP-CXKFWALDSA-N |
| XLogP | 6.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|