C47H33N5OS — CID 46184794
7-(4-azidophenyl)-2,12,17-tris(4-methylphenyl)-21-oxa-23-thia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene (PubChem CID 46184794) has the molecular formula C47H33N5OS and a molecular weight of 715.88 g/mol. Its IUPAC name is 7-(4-azidophenyl)-2,12,17-tris(4-methylphenyl)-21-oxa-23-thia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene.
| Compound Name | 7-(4-azidophenyl)-2,12,17-tris(4-methylphenyl)-21-oxa-23-thia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene |
|---|---|
| PubChem CID | 46184794 |
| Molecular Formula | C47H33N5OS |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 715.24 |
| IUPAC Name | 7-(4-azidophenyl)-2,12,17-tris(4-methylphenyl)-21-oxa-23-thia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaene |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc(s4)c(-c4ccc(N=[N+]=[N-])cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2o5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H33N5OS/c1-28-4-10-31(11-5-28)44-36-20-22-38(49-36)46(33-14-8-30(3)9-15-33)42-26-27-43(54-42)47(34-16-18-35(19-17-34)51-52-48)39-23-21-37(50-39)45(41-25-24-40(44)53-41)32-12-6-29(2)7-13-32/h4-27H,1-3H3/b44-36-,44-40-,45-37-,45-41-,46-38-,46-42-,47-39-,47-43- |
| InChIKey | PSBVHKSHVOVAEW-KRKJROFRSA-N |
| XLogP | 14.19 |
| TPSA | 87.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|