About 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one
1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one (PubChem CID 46184840) has the molecular formula C23H31NO3
and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one |
| PubChem CID | 46184840 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one |
| SMILES | COc1cccc(C2N(C3C4CC5CC(C4)CC3C5)C(=O)C2(C)C)c1OC |
| InChI | InChI=1S/C23H31NO3/c1-23(2)21(17-6-5-7-18(26-3)20(17)27-4)24(22(23)25)19-15-9-13-8-14(11-15)12-16(19)10-13/h5-7,13-16,19,21H,8-12H2,1-4H3 |
| InChIKey | IQLJQBVOEBBFDS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one?
The IUPAC name of 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one (CID 46184840) is 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one?
The canonical SMILES for 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one is COc1cccc(C2N(C3C4CC5CC(C4)CC3C5)C(=O)C2(C)C)c1OC.
What is the InChIKey of 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one?
The InChIKey is IQLJQBVOEBBFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3/c1-23(2)21(17-6-5-7-18(26-3)20(17)27-4)24(22(23)25)19-15-9-13-8-14(11-15)12-16(19)10-13/h5-7,13-16,19,21H,8-12H2,1-4H3.
What are the key properties of 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one?
1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one has a molecular weight of 369.51 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-4-(2,3-dimethoxyphenyl)-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 46184840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).