C16H10FN3O3S — CID 46184846
2-[(3-fluorobenzoyl)amino]-4-pyrazin-2-ylthiophene-3-carboxylic acid (PubChem CID 46184846) has the molecular formula C16H10FN3O3S and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-4-pyrazin-2-ylthiophene-3-carboxylic acid.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-4-pyrazin-2-ylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 46184846 |
| Molecular Formula | C16H10FN3O3S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-4-pyrazin-2-ylthiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2cnccn2)c1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H10FN3O3S/c17-10-3-1-2-9(6-10)14(21)20-15-13(16(22)23)11(8-24-15)12-7-18-4-5-19-12/h1-8H,(H,20,21)(H,22,23) |
| InChIKey | XRJOQODQONYBIK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |