About 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one
1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one (PubChem CID 46185107) has the molecular formula C22H25ClF3NO
and a molecular weight of 411.90 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one |
| PubChem CID | 46185107 |
| Molecular Formula | C22H25ClF3NO |
| Molecular Weight | 411.90 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC(C3)CC2C4)C1c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C22H25ClF3NO/c1-21(2)19(15-4-3-5-16(17(15)23)22(24,25)26)27(20(21)28)18-13-7-11-6-12(9-13)10-14(18)8-11/h3-5,11-14,18-19H,6-10H2,1-2H3 |
| InChIKey | RXLDMMIHSZDSDD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.90 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one?
The IUPAC name of 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one (CID 46185107) is 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one?
The canonical SMILES for 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one is CC1(C)C(=O)N(C2C3CC4CC(C3)CC2C4)C1c1cccc(C(F)(F)F)c1Cl.
What is the InChIKey of 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one?
The InChIKey is RXLDMMIHSZDSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClF3NO/c1-21(2)19(15-4-3-5-16(17(15)23)22(24,25)26)27(20(21)28)18-13-7-11-6-12(9-13)10-14(18)8-11/h3-5,11-14,18-19H,6-10H2,1-2H3.
What are the key properties of 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one?
1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one has a molecular weight of 411.90 g/mol, XLogP of 6.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-4-[2-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 46185107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).