About 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid
3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid (PubChem CID 46185400) has the molecular formula C12H7ClN2O2
and a molecular weight of 246.65 g/mol. Its IUPAC name is 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid.
Molecular Properties
| Compound Name | 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid |
| PubChem CID | 46185400 |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c3ncc(Cl)cc3c2c1 |
| InChI | InChI=1S/C12H7ClN2O2/c13-7-4-9-8-3-6(12(16)17)1-2-10(8)15-11(9)14-5-7/h1-5H,(H,14,15)(H,16,17) |
| InChIKey | KKVVOXYCIVACQC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid?
The IUPAC name of 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid (CID 46185400) is 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid.
What is the SMILES notation for 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid?
The canonical SMILES for 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid is O=C(O)c1ccc2[nH]c3ncc(Cl)cc3c2c1.
What is the InChIKey of 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid?
The InChIKey is KKVVOXYCIVACQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2O2/c13-7-4-9-8-3-6(12(16)17)1-2-10(8)15-11(9)14-5-7/h1-5H,(H,14,15)(H,16,17).
What are the key properties of 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid?
3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid has a molecular weight of 246.65 g/mol, XLogP of 3.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-9H-pyrido[2,3-b]indole-6-carboxylic acid is sourced from PubChem (CID 46185400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).