C20H13FN2O3S — CID 46185886
2-[(3-fluorobenzoyl)amino]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid (PubChem CID 46185886) has the molecular formula C20H13FN2O3S and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 46185886 |
| Molecular Formula | C20H13FN2O3S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2c[nH]c3ccccc23)c1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C20H13FN2O3S/c21-12-5-3-4-11(8-12)18(24)23-19-17(20(25)26)15(10-27-19)14-9-22-16-7-2-1-6-13(14)16/h1-10,22H,(H,23,24)(H,25,26) |
| InChIKey | MSNIFKNNTVEEJE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |