C22H19BBrF4N3 — CID 46185907
1-[(4-bromophenyl)methyl]-4-methyl-3,5-diphenyl-1,2,4-triazol-4-ium tetrafluoroborate (PubChem CID 46185907) has the molecular formula C22H19BBrF4N3 and a molecular weight of 492.12 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-methyl-3,5-diphenyl-1,2,4-triazol-4-ium tetrafluoroborate.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-methyl-3,5-diphenyl-1,2,4-triazol-4-ium tetrafluoroborate |
|---|---|
| PubChem CID | 46185907 |
| Molecular Formula | C22H19BBrF4N3 |
| Molecular Weight | 492.12 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-methyl-3,5-diphenyl-1,2,4-triazol-4-ium tetrafluoroborate |
| SMILES | C[n+]1c(-c2ccccc2)nn(Cc2ccc(Br)cc2)c1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H19BrN3.BF4/c1-25-21(18-8-4-2-5-9-18)24-26(16-17-12-14-20(23)15-13-17)22(25)19-10-6-3-7-11-19;2-1(3,4)5/h2-15H,16H2,1H3;/q+1;-1 |
| InChIKey | WQOCRHJSDMILND-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.12 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|