C16H20O5 — CID 46186024
(3aR,5S,9bR)-6,9-dimethoxy-5-propyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one (PubChem CID 46186024) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3aR,5S,9bR)-6,9-dimethoxy-5-propyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one.
| Compound Name | (3aR,5S,9bR)-6,9-dimethoxy-5-propyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one |
|---|---|
| PubChem CID | 46186024 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3aR,5S,9bR)-6,9-dimethoxy-5-propyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one |
| SMILES | CCC[C@@H]1O[C@@H]2CC(=O)O[C@@H]2c2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C16H20O5/c1-4-5-11-14-9(18-2)6-7-10(19-3)15(14)16-12(20-11)8-13(17)21-16/h6-7,11-12,16H,4-5,8H2,1-3H3/t11-,12+,16-/m0/s1 |
| InChIKey | JJCXJOJZSSQYSV-OZVIIMIRSA-N |
| XLogP | 2.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |