C22H34O4 — CID 46186117
methyl (1S,4E,8E,10E,14S)-8-(2-methoxypropan-2-yl)-1,11-dimethyl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-triene-5-carboxylate (PubChem CID 46186117) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is methyl (1S,4E,8E,10E,14S)-8-(2-methoxypropan-2-yl)-1,11-dimethyl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-triene-5-carboxylate.
| Compound Name | methyl (1S,4E,8E,10E,14S)-8-(2-methoxypropan-2-yl)-1,11-dimethyl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-triene-5-carboxylate |
|---|---|
| PubChem CID | 46186117 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | methyl (1S,4E,8E,10E,14S)-8-(2-methoxypropan-2-yl)-1,11-dimethyl-15-oxabicyclo[12.1.0]pentadeca-4,8,10-triene-5-carboxylate |
| SMILES | COC(=O)/C1=C/CC[C@]2(C)O[C@H]2CC/C(C)=C/C=C(/C(C)(C)OC)CC1 |
| InChI | InChI=1S/C22H34O4/c1-16-9-12-18(21(2,3)25-6)13-11-17(20(23)24-5)8-7-15-22(4)19(26-22)14-10-16/h8-9,12,19H,7,10-11,13-15H2,1-6H3/b16-9+,17-8+,18-12+/t19-,22-/m0/s1 |
| InChIKey | QBAHATLPNPAHMV-WLGSBYHKSA-N |
| XLogP | 4.90 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|