C20H26BrClN3O6P — CID 46186169
[2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]piperidin-3-yl] diethyl phosphate (PubChem CID 46186169) has the molecular formula C20H26BrClN3O6P and a molecular weight of 550.77 g/mol. Its IUPAC name is [2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]piperidin-3-yl] diethyl phosphate.
| Compound Name | [2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]piperidin-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 46186169 |
| Molecular Formula | C20H26BrClN3O6P |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | [2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]piperidin-3-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1CCCNC1CC(=O)Cn1cnc2cc(Br)c(Cl)cc2c1=O |
| InChI | InChI=1S/C20H26BrClN3O6P/c1-3-29-32(28,30-4-2)31-19-6-5-7-23-18(19)8-13(26)11-25-12-24-17-10-15(21)16(22)9-14(17)20(25)27/h9-10,12,18-19,23H,3-8,11H2,1-2H3 |
| InChIKey | MDKSMBFGWVHQGW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|