About [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate
[(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 46186337) has the molecular formula C17H28O3Si
and a molecular weight of 308.49 g/mol. Its IUPAC name is [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| PubChem CID | 46186337 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CCCC[C@H]1OC[C@H](OC(C)=O)C(C)=C1C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-7-8-9-16-15(10-11-21(4,5)6)13(2)17(12-19-16)20-14(3)18/h16-17H,7-9,12H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | TXQPCWSCRNQYLL-SJORKVTESA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate?
The IUPAC name of [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (CID 46186337) is [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
What is the SMILES notation for [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate?
The canonical SMILES for [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate is CCCC[C@H]1OC[C@H](OC(C)=O)C(C)=C1C#C[Si](C)(C)C.
What is the InChIKey of [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate?
The InChIKey is TXQPCWSCRNQYLL-SJORKVTESA-N. The full InChI is InChI=1S/C17H28O3Si/c1-7-8-9-16-15(10-11-21(4,5)6)13(2)17(12-19-16)20-14(3)18/h16-17H,7-9,12H2,1-6H3/t16-,17+/m1/s1.
What are the key properties of [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate?
[(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate has a molecular weight of 308.49 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6R)-6-butyl-4-methyl-5-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate is sourced from PubChem (CID 46186337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).