C14H16BrNO3S — CID 46186551
(3aR,6R,6aR)-6-(bromomethyl)-2,2-dimethyl-5-oxido-4-phenylsulfanyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 46186551) has the molecular formula C14H16BrNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-(bromomethyl)-2,2-dimethyl-5-oxido-4-phenylsulfanyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aR,6R,6aR)-6-(bromomethyl)-2,2-dimethyl-5-oxido-4-phenylsulfanyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 46186551 |
| Molecular Formula | C14H16BrNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | (3aR,6R,6aR)-6-(bromomethyl)-2,2-dimethyl-5-oxido-4-phenylsulfanyl-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)C(Sc1ccccc1)=[N+]([O-])[C@H]2CBr |
| InChI | InChI=1S/C14H16BrNO3S/c1-14(2)18-11-10(8-15)16(17)13(12(11)19-14)20-9-6-4-3-5-7-9/h3-7,10-12H,8H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | WXQKKAYYVXTXTE-QJPTWQEYSA-N |
| XLogP | 2.98 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|