C14H9N5O3 — CID 46186590
8-(2-oxo-1H-quinolin-3-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 46186590) has the molecular formula C14H9N5O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 8-(2-oxo-1H-quinolin-3-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2-oxo-1H-quinolin-3-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 46186590 |
| Molecular Formula | C14H9N5O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 8-(2-oxo-1H-quinolin-3-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3cc4ccccc4[nH]c3=O)nc2[nH]1 |
| InChI | InChI=1S/C14H9N5O3/c20-12-7(5-6-3-1-2-4-8(6)15-12)10-16-9-11(17-10)18-14(22)19-13(9)21/h1-5H,(H,15,20)(H3,16,17,18,19,21,22) |
| InChIKey | RHBSCCVJCASAIP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |