C28H38N4O2S2 — CID 46186708
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]naphthalene-2-sulfonamide (PubChem CID 46186708) has the molecular formula C28H38N4O2S2 and a molecular weight of 526.77 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 46186708 |
| Molecular Formula | C28H38N4O2S2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]naphthalene-2-sulfonamide |
| SMILES | CCCN(CCC1CCC(NS(=O)(=O)c2ccc3ccccc3c2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C28H38N4O2S2/c1-2-16-32(24-12-14-26-27(19-24)35-28(29)30-26)17-15-20-7-10-23(11-8-20)31-36(33,34)25-13-9-21-5-3-4-6-22(21)18-25/h3-6,9,13,18,20,23-24,31H,2,7-8,10-12,14-17,19H2,1H3,(H2,29,30)/t20?,23?,24-/m0/s1 |
| InChIKey | RCHNJYNOHFAIOZ-BOYUCYPVSA-N |
| XLogP | 5.38 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |