C30H40N4O2S2 — CID 46186710
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-phenylbenzenesulfonamide (PubChem CID 46186710) has the molecular formula C30H40N4O2S2 and a molecular weight of 552.81 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 46186710 |
| Molecular Formula | C30H40N4O2S2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-phenylbenzenesulfonamide |
| SMILES | CCCN(CCC1CCC(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C30H40N4O2S2/c1-2-19-34(26-14-17-28-29(21-26)37-30(31)32-28)20-18-22-8-12-25(13-9-22)33-38(35,36)27-15-10-24(11-16-27)23-6-4-3-5-7-23/h3-7,10-11,15-16,22,25-26,33H,2,8-9,12-14,17-21H2,1H3,(H2,31,32)/t22?,25?,26-/m0/s1 |
| InChIKey | RWXOWUCPWWIGIP-BOPKNSRXSA-N |
| XLogP | 5.89 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |