C54H102O13 — CID 46186776
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate (PubChem CID 46186776) has the molecular formula C54H102O13 and a molecular weight of 959.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate |
|---|---|
| PubChem CID | 46186776 |
| Molecular Formula | C54H102O13 |
| Molecular Weight | 959.40 g/mol |
| Exact Mass | 958.73 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)CC(=O)OC[C@H]1O[C@H](O[C@H]2O[C@H](COC(=O)CC(CCCCCCCCC)CCCCCCCCC)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C54H102O13/c1-5-9-13-17-21-25-29-33-41(34-30-26-22-18-14-10-6-2)37-45(55)63-39-43-47(57)49(59)51(61)53(65-43)67-54-52(62)50(60)48(58)44(66-54)40-64-46(56)38-42(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h41-44,47-54,57-62H,5-40H2,1-4H3/t43-,44-,47-,48-,49+,50+,51-,52-,53-,54-/m1/s1 |
| InChIKey | UQMXIEVSCRFPEI-PKTVYVHXSA-N |
| XLogP | 10.28 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.40 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|