C20H14O6 — CID 46186835
(2S,10S)-6-hydroxy-7-methoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione (PubChem CID 46186835) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is (2S,10S)-6-hydroxy-7-methoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione.
| Compound Name | (2S,10S)-6-hydroxy-7-methoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione |
|---|---|
| PubChem CID | 46186835 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2S,10S)-6-hydroxy-7-methoxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione |
| SMILES | COc1cc2c(cc1O)O[C@@H]1C3=C(OC[C@H]21)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H14O6/c1-24-15-6-11-12-8-25-20-16(19(12)26-14(11)7-13(15)21)17(22)9-4-2-3-5-10(9)18(20)23/h2-7,12,19,21H,8H2,1H3/t12-,19+/m1/s1 |
| InChIKey | WCXJMDMAPOPKPX-BLVKFPJESA-N |
| XLogP | 2.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|