C34H34ClN9O — CID 46186904
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[3-(dimethylamino)propyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46186904) has the molecular formula C34H34ClN9O and a molecular weight of 620.16 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[3-(dimethylamino)propyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[3-(dimethylamino)propyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46186904 |
| Molecular Formula | C34H34ClN9O |
| Molecular Weight | 620.16 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[3-(dimethylamino)propyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NCCCN(C)C)nc(Nc5ccccc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C34H34ClN9O/c1-44(2)19-7-18-36-32-41-33(38-23-8-5-4-6-9-23)43-34(42-32)39-25-13-11-24(12-14-25)37-31-27-16-10-22(35)20-30(27)40-29-17-15-26(45-3)21-28(29)31/h4-6,8-17,20-21H,7,18-19H2,1-3H3,(H,37,40)(H3,36,38,39,41,42,43) |
| InChIKey | KPABZGMYVOPXDS-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.16 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|