C18H19FO — CID 46186906
(1R,7S,7aR)-1-(2-fluorophenyl)-4-methyl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran (PubChem CID 46186906) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is (1R,7S,7aR)-1-(2-fluorophenyl)-4-methyl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran.
| Compound Name | (1R,7S,7aR)-1-(2-fluorophenyl)-4-methyl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 46186906 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (1R,7S,7aR)-1-(2-fluorophenyl)-4-methyl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran |
| SMILES | C=C(C)[C@H]1CC=C(C)C2=CO[C@@H](c3ccccc3F)[C@@H]21 |
| InChI | InChI=1S/C18H19FO/c1-11(2)13-9-8-12(3)15-10-20-18(17(13)15)14-6-4-5-7-16(14)19/h4-8,10,13,17-18H,1,9H2,2-3H3/t13-,17-,18+/m1/s1 |
| InChIKey | HHKOLNZOSYJQOI-XWIAVFTESA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|