C26H36O9 — CID 46186997
[(1R,4aS,6Z,8S,9R,11aR)-4-[(1R,2S)-1,2-diacetyloxy-4-methylpent-3-enyl]-8,9-dihydroxy-7-methyl-11-methylidene-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate (PubChem CID 46186997) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(1R,4aS,6Z,8S,9R,11aR)-4-[(1R,2S)-1,2-diacetyloxy-4-methylpent-3-enyl]-8,9-dihydroxy-7-methyl-11-methylidene-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate.
| Compound Name | [(1R,4aS,6Z,8S,9R,11aR)-4-[(1R,2S)-1,2-diacetyloxy-4-methylpent-3-enyl]-8,9-dihydroxy-7-methyl-11-methylidene-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
|---|---|
| PubChem CID | 46186997 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(1R,4aS,6Z,8S,9R,11aR)-4-[(1R,2S)-1,2-diacetyloxy-4-methylpent-3-enyl]-8,9-dihydroxy-7-methyl-11-methylidene-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
| SMILES | C=C1C[C@@H](O)[C@@H](O)/C(C)=C\C[C@@H]2C([C@@H](OC(C)=O)[C@H](C=C(C)C)OC(C)=O)=CO[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C26H36O9/c1-13(2)10-22(33-16(5)27)25(34-17(6)28)20-12-32-26(35-18(7)29)23-15(4)11-21(30)24(31)14(3)8-9-19(20)23/h8,10,12,19,21-26,30-31H,4,9,11H2,1-3,5-7H3/b14-8-/t19-,21-,22+,23+,24+,25-,26-/m1/s1 |
| InChIKey | VFJIIFXMPRKDFM-SQZAKAIFSA-N |
| XLogP | 2.87 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|