About 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one
7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one (PubChem CID 46187089) has the molecular formula C8H7NO3S2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one.
Molecular Properties
| Compound Name | 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one |
| PubChem CID | 46187089 |
| Molecular Formula | C8H7NO3S2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one |
| SMILES | NCc1cccc2c1S(=O)(=O)SC2=O |
| InChI | InChI=1S/C8H7NO3S2/c9-4-5-2-1-3-6-7(5)14(11,12)13-8(6)10/h1-3H,4,9H2 |
| InChIKey | YUVRKZQYCJWNPK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one?
The IUPAC name of 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one (CID 46187089) is 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one.
What is the SMILES notation for 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one?
The canonical SMILES for 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one is NCc1cccc2c1S(=O)(=O)SC2=O.
What is the InChIKey of 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one?
The InChIKey is YUVRKZQYCJWNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S2/c9-4-5-2-1-3-6-7(5)14(11,12)13-8(6)10/h1-3H,4,9H2.
What are the key properties of 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one?
7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one has a molecular weight of 229.28 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-1,1-dioxo-1λ6,2-benzodithiol-3-one is sourced from PubChem (CID 46187089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).