C16H16ClF3N2O2 — CID 46187887
8-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluorooctan-2-one (PubChem CID 46187887) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is 8-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluorooctan-2-one.
| Compound Name | 8-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluorooctan-2-one |
|---|---|
| PubChem CID | 46187887 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 8-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluorooctan-2-one |
| SMILES | O=C(CCCCCCc1nc(-c2ccccc2Cl)no1)C(F)(F)F |
| InChI | InChI=1S/C16H16ClF3N2O2/c17-12-8-6-5-7-11(12)15-21-14(24-22-15)10-4-2-1-3-9-13(23)16(18,19)20/h5-8H,1-4,9-10H2 |
| InChIKey | KNVWEOVHLXUVPP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|