C17H19F3N2O3 — CID 46187890
1,1,1-trifluoro-8-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]octan-2-one (PubChem CID 46187890) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-8-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]octan-2-one.
| Compound Name | 1,1,1-trifluoro-8-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]octan-2-one |
|---|---|
| PubChem CID | 46187890 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1,1,1-trifluoro-8-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]octan-2-one |
| SMILES | COc1ccc(-c2noc(CCCCCCC(=O)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H19F3N2O3/c1-24-13-10-8-12(9-11-13)16-21-15(25-22-16)7-5-3-2-4-6-14(23)17(18,19)20/h8-11H,2-7H2,1H3 |
| InChIKey | XUNMUTLLECBBTD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|