About methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate
methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate (PubChem CID 46187895) has the molecular formula C22H42O3Si
and a molecular weight of 382.66 g/mol. Its IUPAC name is methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate.
Molecular Properties
| Compound Name | methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate |
| PubChem CID | 46187895 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate |
| SMILES | COC(=O)CC(C)(C)CC[C@H]1C=CC[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-16(2)26(17(3)4,18(5)6)25-20-12-10-11-19(20)13-14-22(7,8)15-21(23)24-9/h10-11,16-20H,12-15H2,1-9H3/t19-,20+/m1/s1 |
| InChIKey | SVFALIMEWXEBQK-UXHICEINSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate?
The IUPAC name of methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate (CID 46187895) is methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate.
What is the SMILES notation for methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate?
The canonical SMILES for methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate is COC(=O)CC(C)(C)CC[C@H]1C=CC[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate?
The InChIKey is SVFALIMEWXEBQK-UXHICEINSA-N. The full InChI is InChI=1S/C22H42O3Si/c1-16(2)26(17(3)4,18(5)6)25-20-12-10-11-19(20)13-14-22(7,8)15-21(23)24-9/h10-11,16-20H,12-15H2,1-9H3/t19-,20+/m1/s1.
What are the key properties of methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate?
methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate has a molecular weight of 382.66 g/mol, XLogP of 6.49, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,3-dimethyl-5-[(1S,5S)-5-tri(propan-2-yl)silyloxycyclopent-2-en-1-yl]pentanoate is sourced from PubChem (CID 46187895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).