C16H17F3N2O2 — CID 46188075
1,1,1-trifluoro-8-(3-phenyl-1,2,4-oxadiazol-5-yl)octan-2-one (PubChem CID 46188075) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-8-(3-phenyl-1,2,4-oxadiazol-5-yl)octan-2-one.
| Compound Name | 1,1,1-trifluoro-8-(3-phenyl-1,2,4-oxadiazol-5-yl)octan-2-one |
|---|---|
| PubChem CID | 46188075 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1,1,1-trifluoro-8-(3-phenyl-1,2,4-oxadiazol-5-yl)octan-2-one |
| SMILES | O=C(CCCCCCc1nc(-c2ccccc2)no1)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)13(22)10-6-1-2-7-11-14-20-15(21-23-14)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,10-11H2 |
| InChIKey | RXPBVZUTMFSAEV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|