C22H22FN5O3 — CID 46188367
(2S)-2-amino-N-[(3S)-6-(aziridin-1-yl)-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]-3-(4-fluorophenyl)propanamide (PubChem CID 46188367) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-6-(aziridin-1-yl)-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-6-(aziridin-1-yl)-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 46188367 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-6-(aziridin-1-yl)-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl]-3-(4-fluorophenyl)propanamide |
| SMILES | CC1=C(N2CC2)C(=O)c2nc3n(c2C1=O)CC[C@@H]3NC(=O)[C@@H](N)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN5O3/c1-11-17(27-8-9-27)20(30)16-18(19(11)29)28-7-6-15(21(28)26-16)25-22(31)14(24)10-12-2-4-13(23)5-3-12/h2-5,14-15H,6-10,24H2,1H3,(H,25,31)/t14-,15-/m0/s1 |
| InChIKey | GGGKGGAKYLLDIZ-GJZGRUSLSA-N |
| XLogP | 1.12 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|