C22H21NO5 — CID 46188458
(20S)-4,5,10-trimethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2,4,6,8(13),9,11-heptaen-17-one (PubChem CID 46188458) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is (20S)-4,5,10-trimethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2,4,6,8(13),9,11-heptaen-17-one.
| Compound Name | (20S)-4,5,10-trimethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2,4,6,8(13),9,11-heptaen-17-one |
|---|---|
| PubChem CID | 46188458 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (20S)-4,5,10-trimethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1(14),2,4,6,8(13),9,11-heptaen-17-one |
| SMILES | COc1ccc2c3c(c4cc(OC)c(OC)cc4c2c1)C[C@H]1COC(=O)N1C3 |
| InChI | InChI=1S/C22H21NO5/c1-25-13-4-5-14-16(7-13)18-9-21(27-3)20(26-2)8-17(18)15-6-12-11-28-22(24)23(12)10-19(14)15/h4-5,7-9,12H,6,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | BVHCJFNANKXSGX-LBPRGKRZSA-N |
| XLogP | 3.90 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|