C31H39NO6 — CID 46188977
(2S,3S,4S,5S)-2-(3,3-dimethoxypropyl)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 46188977) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-(3,3-dimethoxypropyl)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2S,3S,4S,5S)-2-(3,3-dimethoxypropyl)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 46188977 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | (2S,3S,4S,5S)-2-(3,3-dimethoxypropyl)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | COC(CC[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](COCc2ccccc2)N1O)OC |
| InChI | InChI=1S/C31H39NO6/c1-34-29(35-2)19-18-27-30(37-21-25-14-8-4-9-15-25)31(38-22-26-16-10-5-11-17-26)28(32(27)33)23-36-20-24-12-6-3-7-13-24/h3-17,27-31,33H,18-23H2,1-2H3/t27-,28-,30-,31-/m0/s1 |
| InChIKey | YAZLTIHPTDGERN-QMMMHVTISA-N |
| XLogP | 5.22 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|