About morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone
morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone (PubChem CID 46188987) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone |
| PubChem CID | 46188987 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone |
| SMILES | C=CCCCO[C@H]1C[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H21NO3/c1-2-3-4-7-17-12-10-11(12)13(15)14-5-8-16-9-6-14/h2,11-12H,1,3-10H2/t11-,12-/m0/s1 |
| InChIKey | COSCSPXJKCWBLY-RYUDHWBXSA-N |
| XLogP | 1.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone?
The IUPAC name of morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone (CID 46188987) is morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone.
What is the SMILES notation for morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone?
The canonical SMILES for morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone is C=CCCCO[C@H]1C[C@@H]1C(=O)N1CCOCC1.
What is the InChIKey of morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone?
The InChIKey is COSCSPXJKCWBLY-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H21NO3/c1-2-3-4-7-17-12-10-11(12)13(15)14-5-8-16-9-6-14/h2,11-12H,1,3-10H2/t11-,12-/m0/s1.
What are the key properties of morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone?
morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone has a molecular weight of 239.31 g/mol, XLogP of 1.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[(1S,2S)-2-pent-4-enoxycyclopropyl]methanone is sourced from PubChem (CID 46188987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).