C29H23N5O5 — CID 46188993
benzyl N-benzyl-N-[3-(4-nitrophenyl)-5-oxo-1-phenyl-1,2,4-triazol-4-yl]carbamate (PubChem CID 46188993) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is benzyl N-benzyl-N-[3-(4-nitrophenyl)-5-oxo-1-phenyl-1,2,4-triazol-4-yl]carbamate.
| Compound Name | benzyl N-benzyl-N-[3-(4-nitrophenyl)-5-oxo-1-phenyl-1,2,4-triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 46188993 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | benzyl N-benzyl-N-[3-(4-nitrophenyl)-5-oxo-1-phenyl-1,2,4-triazol-4-yl]carbamate |
| SMILES | O=C(OCc1ccccc1)N(Cc1ccccc1)n1c(-c2ccc([N+](=O)[O-])cc2)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C29H23N5O5/c35-28-32(25-14-8-3-9-15-25)30-27(24-16-18-26(19-17-24)34(37)38)33(28)31(20-22-10-4-1-5-11-22)29(36)39-21-23-12-6-2-7-13-23/h1-19H,20-21H2 |
| InChIKey | HROKAIZPNPSFBF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|