C15H30O4 — CID 46189035
(1R)-1-[(3S,4R,6S)-4-ethyl-6-(2-ethylbutyl)-6-methyldioxan-3-yl]ethane-1,2-diol (PubChem CID 46189035) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1R)-1-[(3S,4R,6S)-4-ethyl-6-(2-ethylbutyl)-6-methyldioxan-3-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3S,4R,6S)-4-ethyl-6-(2-ethylbutyl)-6-methyldioxan-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 46189035 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (1R)-1-[(3S,4R,6S)-4-ethyl-6-(2-ethylbutyl)-6-methyldioxan-3-yl]ethane-1,2-diol |
| SMILES | CCC(CC)C[C@@]1(C)C[C@@H](CC)[C@@H]([C@H](O)CO)OO1 |
| InChI | InChI=1S/C15H30O4/c1-5-11(6-2)8-15(4)9-12(7-3)14(18-19-15)13(17)10-16/h11-14,16-17H,5-10H2,1-4H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | CZTQTWXYAHGGMN-KBXIAJHMSA-N |
| XLogP | 2.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|