About (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol
(2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol (PubChem CID 46189389) has the molecular formula C14H25ClO
and a molecular weight of 244.81 g/mol. Its IUPAC name is (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol |
| PubChem CID | 46189389 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol |
| SMILES | CC(C)[C@@H]1C=C(CC[C@H](O)CCl)[C@H](C)CC1 |
| InChI | InChI=1S/C14H25ClO/c1-10(2)12-5-4-11(3)13(8-12)6-7-14(16)9-15/h8,10-12,14,16H,4-7,9H2,1-3H3/t11-,12+,14+/m1/s1 |
| InChIKey | VWJSVWFVJZULMW-DYEKYZERSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol?
The IUPAC name of (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol (CID 46189389) is (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol.
What is the SMILES notation for (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol?
The canonical SMILES for (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol is CC(C)[C@@H]1C=C(CC[C@H](O)CCl)[C@H](C)CC1.
What is the InChIKey of (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol?
The InChIKey is VWJSVWFVJZULMW-DYEKYZERSA-N. The full InChI is InChI=1S/C14H25ClO/c1-10(2)12-5-4-11(3)13(8-12)6-7-14(16)9-15/h8,10-12,14,16H,4-7,9H2,1-3H3/t11-,12+,14+/m1/s1.
What are the key properties of (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol?
(2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol has a molecular weight of 244.81 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-chloro-4-[(3R,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol is sourced from PubChem (CID 46189389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).