C30H41N5O2S — CID 46189415
tert-butyl (2S)-2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 46189415) has the molecular formula C30H41N5O2S and a molecular weight of 535.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46189415 |
| Molecular Formula | C30H41N5O2S |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | tert-butyl (2S)-2-[[[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](NC(=S)NC[C@@H]1CCCN1C(=O)OC(C)(C)C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C30H41N5O2S/c1-5-20-19-34-16-13-21(20)17-26(34)27(24-12-14-31-25-11-7-6-10-23(24)25)33-28(38)32-18-22-9-8-15-35(22)29(36)37-30(2,3)4/h5-7,10-12,14,20-22,26-27H,1,8-9,13,15-19H2,2-4H3,(H2,32,33,38)/t20-,21-,22-,26-,27-/m0/s1 |
| InChIKey | JKXFNPBLYZWQNL-UBJSKUQYSA-N |
| XLogP | 5.04 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|