About (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one
(4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one (PubChem CID 46189443) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one |
| PubChem CID | 46189443 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H]([C@H]2CC=CCO2)CO1 |
| InChI | InChI=1S/C8H11NO3/c10-8-9-6(5-12-8)7-3-1-2-4-11-7/h1-2,6-7H,3-5H2,(H,9,10)/t6-,7-/m1/s1 |
| InChIKey | PHOXUEDSWVIIBW-RNFRBKRXSA-N |
| XLogP | 0.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one?
The IUPAC name of (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one (CID 46189443) is (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one?
The canonical SMILES for (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one is O=C1N[C@@H]([C@H]2CC=CCO2)CO1.
What is the InChIKey of (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one?
The InChIKey is PHOXUEDSWVIIBW-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H11NO3/c10-8-9-6(5-12-8)7-3-1-2-4-11-7/h1-2,6-7H,3-5H2,(H,9,10)/t6-,7-/m1/s1.
What are the key properties of (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one?
(4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one has a molecular weight of 169.18 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(2R)-3,6-dihydro-2H-pyran-2-yl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 46189443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).