About 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine
4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine (PubChem CID 46189893) has the molecular formula C18H18F3NO
and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine.
Molecular Properties
| Compound Name | 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine |
| PubChem CID | 46189893 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine |
| SMILES | Fc1cc(F)c(OCc2ccccc2C2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C18H18F3NO/c19-14-9-16(20)18(17(21)10-14)23-11-13-3-1-2-4-15(13)12-5-7-22-8-6-12/h1-4,9-10,12,22H,5-8,11H2 |
| InChIKey | TZIALEBTHQWNAO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine?
The IUPAC name of 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine (CID 46189893) is 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine.
What is the SMILES notation for 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine?
The canonical SMILES for 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine is Fc1cc(F)c(OCc2ccccc2C2CCNCC2)c(F)c1.
What is the InChIKey of 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine?
The InChIKey is TZIALEBTHQWNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO/c19-14-9-16(20)18(17(21)10-14)23-11-13-3-1-2-4-15(13)12-5-7-22-8-6-12/h1-4,9-10,12,22H,5-8,11H2.
What are the key properties of 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine?
4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine has a molecular weight of 321.34 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2,4,6-trifluorophenoxy)methyl]phenyl]piperidine is sourced from PubChem (CID 46189893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).