About 4-(2-bromophenyl)-2,4-dioxobutanoic acid
4-(2-bromophenyl)-2,4-dioxobutanoic acid (PubChem CID 46190492) has the molecular formula C10H7BrO4
and a molecular weight of 271.07 g/mol. Its IUPAC name is 4-(2-bromophenyl)-2,4-dioxobutanoic acid.
Molecular Properties
| Compound Name | 4-(2-bromophenyl)-2,4-dioxobutanoic acid |
| PubChem CID | 46190492 |
| Molecular Formula | C10H7BrO4 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 4-(2-bromophenyl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccccc1Br |
| InChI | InChI=1S/C10H7BrO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5H2,(H,14,15) |
| InChIKey | HQXXYSXUODFGRE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromophenyl)-2,4-dioxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenyl)-2,4-dioxobutanoic acid?
The IUPAC name of 4-(2-bromophenyl)-2,4-dioxobutanoic acid (CID 46190492) is 4-(2-bromophenyl)-2,4-dioxobutanoic acid.
What is the SMILES notation for 4-(2-bromophenyl)-2,4-dioxobutanoic acid?
The canonical SMILES for 4-(2-bromophenyl)-2,4-dioxobutanoic acid is O=C(O)C(=O)CC(=O)c1ccccc1Br.
What is the InChIKey of 4-(2-bromophenyl)-2,4-dioxobutanoic acid?
The InChIKey is HQXXYSXUODFGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5H2,(H,14,15).
What are the key properties of 4-(2-bromophenyl)-2,4-dioxobutanoic acid?
4-(2-bromophenyl)-2,4-dioxobutanoic acid has a molecular weight of 271.07 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenyl)-2,4-dioxobutanoic acid is sourced from PubChem (CID 46190492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).