C32H46N4O6 — CID 46190730
(E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butylamino]propyl]prop-2-enamide (PubChem CID 46190730) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butylamino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 46190730 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butylamino]propyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCCNCCCCNCCCNC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C32H46N4O6/c1-39-27-13-9-25(23-29(27)41-3)11-15-31(37)35-21-7-19-33-17-5-6-18-34-20-8-22-36-32(38)16-12-26-10-14-28(40-2)30(24-26)42-4/h9-16,23-24,33-34H,5-8,17-22H2,1-4H3,(H,35,37)(H,36,38)/b15-11+,16-12+ |
| InChIKey | CXEGBCYBSKQWAA-JOBJLJCHSA-N |
| XLogP | 3.42 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|