About 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide
7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide (PubChem CID 46190821) has the molecular formula C15H18ClN3O3
and a molecular weight of 323.78 g/mol. Its IUPAC name is 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide.
Molecular Properties
| Compound Name | 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide |
| PubChem CID | 46190821 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCc1nc(-c2ccccc2Cl)no1)NO |
| InChI | InChI=1S/C15H18ClN3O3/c16-12-8-6-5-7-11(12)15-17-14(22-19-15)10-4-2-1-3-9-13(20)18-21/h5-8,21H,1-4,9-10H2,(H,18,20) |
| InChIKey | WMMBHKDJRGCVHO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide?
The IUPAC name of 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide (CID 46190821) is 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide.
What is the SMILES notation for 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide?
The canonical SMILES for 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide is O=C(CCCCCCc1nc(-c2ccccc2Cl)no1)NO.
What is the InChIKey of 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide?
The InChIKey is WMMBHKDJRGCVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O3/c16-12-8-6-5-7-11(12)15-17-14(22-19-15)10-4-2-1-3-9-13(20)18-21/h5-8,21H,1-4,9-10H2,(H,18,20).
What are the key properties of 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide?
7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide has a molecular weight of 323.78 g/mol, XLogP of 3.39, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-hydroxyheptanamide is sourced from PubChem (CID 46190821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).