About 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid
3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid (PubChem CID 46190839) has the molecular formula C22H21ClN2O6
and a molecular weight of 444.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid |
| PubChem CID | 46190839 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid |
| SMILES | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H21ClN2O6/c1-28-17-13-18(29-2)25-21(24-17)31-19(20(26)27)22(30-3,14-7-5-4-6-8-14)15-9-11-16(23)12-10-15/h4-13,19H,1-3H3,(H,26,27) |
| InChIKey | JTNGHWCOAKBQPP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid?
The IUPAC name of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid (CID 46190839) is 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid.
What is the SMILES notation for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid?
The canonical SMILES for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid is COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccc(Cl)cc2)n1.
What is the InChIKey of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid?
The InChIKey is JTNGHWCOAKBQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O6/c1-28-17-13-18(29-2)25-21(24-17)31-19(20(26)27)22(30-3,14-7-5-4-6-8-14)15-9-11-16(23)12-10-15/h4-13,19H,1-3H3,(H,26,27).
What are the key properties of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid?
3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid has a molecular weight of 444.87 g/mol, XLogP of 3.57, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3-phenylpropanoic acid is sourced from PubChem (CID 46190839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).