C17H18N4O2S — CID 46191008
7-hydroxy-N-[(3S)-piperidin-3-yl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide (PubChem CID 46191008) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 7-hydroxy-N-[(3S)-piperidin-3-yl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-hydroxy-N-[(3S)-piperidin-3-yl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 46191008 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 7-hydroxy-N-[(3S)-piperidin-3-yl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)c1ccc(O)c2[nH]c(-c3cccs3)nc12 |
| InChI | InChI=1S/C17H18N4O2S/c22-12-6-5-11(17(23)19-10-3-1-7-18-9-10)14-15(12)21-16(20-14)13-4-2-8-24-13/h2,4-6,8,10,18,22H,1,3,7,9H2,(H,19,23)(H,20,21)/t10-/m0/s1 |
| InChIKey | LJPSIRPRIUNDAT-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |