C18H20N4O2S — CID 46191009
7-hydroxy-N-(piperidin-3-ylmethyl)-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide (PubChem CID 46191009) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 7-hydroxy-N-(piperidin-3-ylmethyl)-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-hydroxy-N-(piperidin-3-ylmethyl)-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 46191009 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 7-hydroxy-N-(piperidin-3-ylmethyl)-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCC1CCCNC1)c1ccc(O)c2[nH]c(-c3cccs3)nc12 |
| InChI | InChI=1S/C18H20N4O2S/c23-13-6-5-12(18(24)20-10-11-3-1-7-19-9-11)15-16(13)22-17(21-15)14-4-2-8-25-14/h2,4-6,8,11,19,23H,1,3,7,9-10H2,(H,20,24)(H,21,22) |
| InChIKey | MTCFCASJWUBVGX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |