C16H16N4O2S — CID 46191078
N-(azetidin-3-ylmethyl)-7-hydroxy-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide (PubChem CID 46191078) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-7-hydroxy-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(azetidin-3-ylmethyl)-7-hydroxy-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 46191078 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-7-hydroxy-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCC1CNC1)c1ccc(O)c2[nH]c(-c3cccs3)nc12 |
| InChI | InChI=1S/C16H16N4O2S/c21-11-4-3-10(16(22)18-8-9-6-17-7-9)13-14(11)20-15(19-13)12-2-1-5-23-12/h1-5,9,17,21H,6-8H2,(H,18,22)(H,19,20) |
| InChIKey | QOQKTKZYZAUZTA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |