C23H20N2O8 — CID 46191195
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(4-nitrophenyl)carbamate (PubChem CID 46191195) has the molecular formula C23H20N2O8 and a molecular weight of 452.42 g/mol. Its IUPAC name is [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(4-nitrophenyl)carbamate.
| Compound Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 46191195 |
| Molecular Formula | C23H20N2O8 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(4-nitrophenyl)carbamate |
| SMILES | CC(C)=CC[C@@H](OC(=O)Nc1ccc([N+](=O)[O-])cc1)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C23H20N2O8/c1-12(2)3-10-19(33-23(30)24-13-4-6-14(7-5-13)25(31)32)15-11-18(28)20-16(26)8-9-17(27)21(20)22(15)29/h3-9,11,19,26-27H,10H2,1-2H3,(H,24,30)/t19-/m1/s1 |
| InChIKey | XXMGBMIJZSAWQX-LJQANCHMSA-N |
| XLogP | 4.28 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|